Introduction:Basic information about CAS 948294-42-6|6,7-Dichloroquinoline-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6,7-Dichloroquinoline-3-carboxylic acid |
|---|
| CAS Number | 948294-42-6 | Molecular Weight | 242.05800 |
|---|
| Density | 1.579g/cm3 | Boiling Point | 415.3ºC at 760 mmHg |
|---|
| Molecular Formula | C10H5Cl2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205ºC |
|---|
Names
| Name | 6,7-Dichloroquinoline-3-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.579g/cm3 |
|---|
| Boiling Point | 415.3ºC at 760 mmHg |
|---|
| Molecular Formula | C10H5Cl2NO2 |
|---|
| Molecular Weight | 242.05800 |
|---|
| Flash Point | 205ºC |
|---|
| Exact Mass | 240.97000 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 3.23980 |
|---|
| Index of Refraction | 1.695 |
|---|
| InChIKey | QVIQAMKOZUQRKA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cnc2cc(Cl)c(Cl)cc2c1 |
|---|