Introduction:Basic information about CAS 948294-45-9|6,7-Dimethylquinoline-2,3-dicarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6,7-Dimethylquinoline-2,3-dicarboxylic acid |
|---|
| CAS Number | 948294-45-9 | Molecular Weight | 245.23100 |
|---|
| Density | 1.406g/cm3 | Boiling Point | 449.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO4 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 225.7ºC |
|---|
Names
| Name | 6,7-Dimethylquinoline-2,3-dicarboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.406g/cm3 |
|---|
| Boiling Point | 449.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO4 |
|---|
| Molecular Weight | 245.23100 |
|---|
| Flash Point | 225.7ºC |
|---|
| Exact Mass | 245.06900 |
|---|
| PSA | 87.49000 |
|---|
| LogP | 2.24800 |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | JGAHTWZHTMWMSG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc2cc(C(=O)O)c(C(=O)O)nc2cc1C |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|