Introduction：Basic information about CAS 930570-34-6|6-bromo-4-chloro-2-propylquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-bromo-4-chloro-2-propylquinoline |
|---|
| CAS Number | 930570-34-6 | Molecular Weight | 284.57900 |
|---|
| Density | 1.465g/cm3 | Boiling Point | 336.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11BrClN | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 157.1ºC |
|---|
| Symbol |
GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 6-bromo-4-chloro-2-propylquinoline |
|---|
Chemical & Physical Properties
| Density | 1.465g/cm3 |
|---|
| Boiling Point | 336.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11BrClN |
|---|
| Molecular Weight | 284.57900 |
|---|
| Flash Point | 157.1ºC |
|---|
| Exact Mass | 282.97600 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.60320 |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | QYFOGUDLBMGKHS-UHFFFAOYSA-N |
|---|
| SMILES | CCCc1cc(Cl)c2cc(Br)ccc2n1 |
|---|
Safety Information
| Symbol |
GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H318-H413 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
