Introduction:Basic information about CAS 948289-26-7|6-Chloro-2,8-dimethylquinoline-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chloro-2,8-dimethylquinoline-3-carboxylic acid |
|---|
| CAS Number | 948289-26-7 | Molecular Weight | 235.66600 |
|---|
| Density | 1.355g/cm3 | Boiling Point | 389.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189.4ºC |
|---|
Names
| Name | 6-Chloro-2,8-dimethylquinoline-3-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.355g/cm3 |
|---|
| Boiling Point | 389.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10ClNO2 |
|---|
| Molecular Weight | 235.66600 |
|---|
| Flash Point | 189.4ºC |
|---|
| Exact Mass | 235.04000 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 3.20320 |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | IYKDDOVXIZQELN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc2c(C)cc(Cl)cc2cc1C(=O)O |
|---|