Introduction:Basic information about CAS 948289-44-9|6-Chloro-8-methylquinoline-2,3-dicarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chloro-8-methylquinoline-2,3-dicarboxylic acid |
|---|
| CAS Number | 948289-44-9 | Molecular Weight | 265.64900 |
|---|
| Density | 1.562g/cm3 | Boiling Point | 466.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.8ºC |
|---|
Names
| Name | 6-Chloro-8-methylquinoline-2,3-dicarboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.562g/cm3 |
|---|
| Boiling Point | 466.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClNO4 |
|---|
| Molecular Weight | 265.64900 |
|---|
| Flash Point | 235.8ºC |
|---|
| Exact Mass | 265.01400 |
|---|
| PSA | 87.49000 |
|---|
| LogP | 2.59300 |
|---|
| Index of Refraction | 1.7 |
|---|
| InChIKey | OJDUVKWEAZRCMD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cl)cc2cc(C(=O)O)c(C(=O)O)nc12 |
|---|