Introduction:Basic information about CAS 948289-56-3|6-Chloro-8-methylquinoline-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chloro-8-methylquinoline-3-carboxylic acid |
|---|
| CAS Number | 948289-56-3 | Molecular Weight | 221.64000 |
|---|
| Density | 1.406g/cm3 | Boiling Point | 397.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8ClNO2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 194.2ºC |
|---|
Names
| Name | 6-Chloro-8-methylquinoline-3-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.406g/cm3 |
|---|
| Boiling Point | 397.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8ClNO2 |
|---|
| Molecular Weight | 221.64000 |
|---|
| Flash Point | 194.2ºC |
|---|
| Exact Mass | 221.02400 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 2.89480 |
|---|
| Index of Refraction | 1.669 |
|---|
| InChIKey | AZUBVKRZQUUAAX-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cl)cc2cc(C(=O)O)cnc12 |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|