Introduction:Basic information about CAS 948289-74-5|6-Ethoxyquinoline-2,3-dicarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Ethoxyquinoline-2,3-dicarboxylic acid |
|---|
| CAS Number | 948289-74-5 | Molecular Weight | 261.23000 |
|---|
| Density | 1.432g/cm3 | Boiling Point | 461.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 232.8ºC |
|---|
Names
| Name | 6-Ethoxyquinoline-2,3-dicarboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.432g/cm3 |
|---|
| Boiling Point | 461.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO5 |
|---|
| Molecular Weight | 261.23000 |
|---|
| Flash Point | 232.8ºC |
|---|
| Exact Mass | 261.06400 |
|---|
| PSA | 96.72000 |
|---|
| LogP | 2.02990 |
|---|
| Index of Refraction | 1.66 |
|---|
| InChIKey | AWLUPZWELMOPGF-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc2nc(C(=O)O)c(C(=O)O)cc2c1 |
|---|