Introduction：Basic information about CAS 948290-22-0|7-Chloro-2,8-dimethylquinoline-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Chloro-2,8-dimethylquinoline-3-carboxylic acid |
|---|
| CAS Number | 948290-22-0 | Molecular Weight | 235.66600 |
|---|
| Density | 1.355g/cm3 | Boiling Point | 386.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10ClNO2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 187.4ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 7-Chloro-2,8-dimethylquinoline-3-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.355g/cm3 |
|---|
| Boiling Point | 386.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10ClNO2 |
|---|
| Molecular Weight | 235.66600 |
|---|
| Flash Point | 187.4ºC |
|---|
| Exact Mass | 235.04000 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 3.20320 |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | XXJOAECAXTVYHG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc2c(C)c(Cl)ccc2cc1C(=O)O |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
