Introduction：Basic information about CAS 887599-64-6|3-[(3-fluorobenzyl)oxy]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[(3-fluorobenzyl)oxy]benzoic acid |
|---|
| CAS Number | 887599-64-6 | Molecular Weight | 246.23400 |
|---|
| Density | 1.289g/cm3 | Boiling Point | 405.8ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11FO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 199.2ºC |
|---|
Names
| Name | 3-[(3-fluorophenyl)methoxy]benzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.289g/cm3 |
|---|
| Boiling Point | 405.8ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11FO3 |
|---|
| Molecular Weight | 246.23400 |
|---|
| Flash Point | 199.2ºC |
|---|
| Exact Mass | 246.06900 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.10290 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | PBEUDJJYJYWQOV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc(OCc2cccc(F)c2)c1 |
|---|
