Introduction:Basic information about CAS 4845-64-1|1H-benzo[e][1,3]benzothiazole-2-thione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-benzo[e][1,3]benzothiazole-2-thione |
|---|
| CAS Number | 4845-64-1 | Molecular Weight | 217.31000 |
|---|
| Density | 1.46g/cm3 | Boiling Point | 413.7ºC at 760mmHg |
|---|
| Molecular Formula | C11H7NS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 204ºC |
|---|
Names
| Name | 1H-benzo[e][1,3]benzothiazole-2-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.46g/cm3 |
|---|
| Boiling Point | 413.7ºC at 760mmHg |
|---|
| Molecular Formula | C11H7NS2 |
|---|
| Molecular Weight | 217.31000 |
|---|
| Flash Point | 204ºC |
|---|
| Exact Mass | 217.00200 |
|---|
| PSA | 79.93000 |
|---|
| LogP | 3.73820 |
|---|
| Index of Refraction | 1.838 |
|---|
| InChIKey | MRORKWHSOOKUDV-UHFFFAOYSA-N |
|---|
| SMILES | S=c1[nH]c2c(ccc3ccccc32)s1 |
|---|
Synonyms
| 2-Mercaptonaphthol(1,2-d)thiazole |
| 2-mercapto-naphth[1,2-d]thiazole |
| 1H-Naphtho[1,2-d]thiazol-2-thion |
| naphtho[1,2-d]thiazole-2(1H)-thione |
| 1H-naphtho[1,2-d]thiazole-2-thione |