Introduction:Basic information about CAS 4827-55-8|Bis(2-Ethylhexyl) Chlorendate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(2-Ethylhexyl) Chlorendate |
|---|
| CAS Number | 4827-55-8 | Molecular Weight | 613.269 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 583.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H36Cl6O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 156.1±29.1 °C |
|---|
Names
| Name | bis(2-ethylhexyl) 1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene-5,6-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 583.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H36Cl6O4 |
|---|
| Molecular Weight | 613.269 |
|---|
| Flash Point | 156.1±29.1 °C |
|---|
| Exact Mass | 610.074463 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 12.74 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.531 |
|---|
| InChIKey | ONIHOIFWLALAQH-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)COC(=O)C1C(C(=O)OCC(CC)CCCC)C2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 36 |
|---|
| Safety Phrases | 26-37/39 |
|---|
Synonyms
| Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro-, bis(2-ethylhexyl) ester |
| 2-ethylhexyl 1,4,5,6,7,7-hexachloro-3-[(2-ethylhexyl)oxycarbonyl]bicyclo[2.2.1 ]hept-5-ene-2-carboxylate |
| Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid,1,4,5,6,7,7-hexachloro-,bis(2-ethylhexyl) ester |
| Di-2-ethylhexyl chlorendate |
| 5-Norbornene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro-, bis(2-ethylhexyl) ester |
| EINECS 225-405-1 |
| bis(2-ethylhexyl) chlorendate |
| MFCD00213562 |
| Bis(2-ethylhexyl) 1,4,5,6,7,7-hexachlorobicyclo(2.2.1)hept-5-ene-2,3-dicarboxylate |
| Bis(2-ethylhexyl) 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| Bicyclo(2.2.1)hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro-, bis(2-ethylhexyl) ester |