Introduction:Basic information about CAS 29880-25-9|L-Asparagine,N2-benzoyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | L-Asparagine,N2-benzoyl- |
|---|
| CAS Number | 29880-25-9 | Molecular Weight | 236.22400 |
|---|
| Density | 1.349g/cm3 | Boiling Point | 629ºC at 760mmHg |
|---|
| Molecular Formula | C11H12N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 334.2ºC |
|---|
Names
| Name | 4-amino-2-benzamido-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.349g/cm3 |
|---|
| Boiling Point | 629ºC at 760mmHg |
|---|
| Molecular Formula | C11H12N2O4 |
|---|
| Molecular Weight | 236.22400 |
|---|
| Flash Point | 334.2ºC |
|---|
| Exact Mass | 236.08000 |
|---|
| PSA | 109.49000 |
|---|
| LogP | 0.83620 |
|---|
| Vapour Pressure | 1.09E-16mmHg at 25°C |
|---|
| InChIKey | CNRAIJZCOJXFAK-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)CC(NC(=O)c1ccccc1)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N2-benzoyl-L-asparagine |
| 2-Benzoylamino-succinamic acid |
| N-Benzoyl-asparagin |
| benzoylasparagine |
| N-Benzoyl-l-asparagine |
| n2-benzoylasparagine |
| N2-Benzoyl-L-asparagin |