Introduction：Basic information about CAS 27895-95-0|Ethanone,2-bromo-1,2-bis(4-methoxyphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethanone,2-bromo-1,2-bis(4-methoxyphenyl)- |
|---|
| CAS Number | 27895-95-0 | Molecular Weight | 335.19300 |
|---|
| Density | 1.375g/cm3 | Boiling Point | 442.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H15BrO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.2ºC |
|---|
Names
| Name | 2-bromo-1,2-bis(4-methoxyphenyl)ethanone |
|---|
Chemical & Physical Properties
| Density | 1.375g/cm3 |
|---|
| Boiling Point | 442.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H15BrO3 |
|---|
| Molecular Weight | 335.19300 |
|---|
| Flash Point | 221.2ºC |
|---|
| Exact Mass | 334.02000 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 4.02270 |
|---|
| Vapour Pressure | 5.17E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | BJCIJTYQFAOPCE-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)C(Br)c2ccc(OC)cc2)cc1 |
|---|
