Introduction：Basic information about CAS 2915-57-3|bis(2-ethylhexyl) succinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(2-ethylhexyl) succinate |
|---|
| CAS Number | 2915-57-3 | Molecular Weight | 342.51300 |
|---|
| Density | 0.934 g/cm3 | Boiling Point | 358.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H38O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158ºC |
|---|
Names
| Name | bis(2-ethylhexyl) butanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.934 g/cm3 |
|---|
| Boiling Point | 358.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H38O4 |
|---|
| Molecular Weight | 342.51300 |
|---|
| Flash Point | 158ºC |
|---|
| Exact Mass | 342.27700 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 5.28580 |
|---|
| Vapour Pressure | 2.46E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.448 |
|---|
| InChIKey | WMNULTDOANGXRT-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)COC(=O)CCC(=O)OCC(CC)CCCC |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Wickenol 159 |
| succinic acid bis-(2-ethyl-hexyl ester) |
| Bernsteinsaeure-bis-(2-aethyl-hexylester) |
| Di-2-ethylhexyl succinate |
| Di(2-ethylhexyl)butanedioate |
| Butanedioic acid,bis(2-ethylhexyl) ester |
| Bis(2-ethylhexyl) succinate |
| 2-ethyl-hexyl succinate |
