Introduction：Basic information about CAS 2750-76-7|rifamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | rifamide |
|---|
| CAS Number | 2750-76-7 | Molecular Weight | 810.92600 |
|---|
| Density | 1.3g/cm3 | Boiling Point | 927.4ºC at 760mmHg |
|---|
| Molecular Formula | C43H58N2O13 | Melting Point | 170°C (rough estimate) |
|---|
| MSDS | / | Flash Point | 514.7ºC |
|---|
Names
| Name | Rifampicin M/14 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Boiling Point | 927.4ºC at 760mmHg |
|---|
| Melting Point | 170°C (rough estimate) |
|---|
| Molecular Formula | C43H58N2O13 |
|---|
| Molecular Weight | 810.92600 |
|---|
| Flash Point | 514.7ºC |
|---|
| Exact Mass | 810.39400 |
|---|
| PSA | 210.62000 |
|---|
| LogP | 5.43370 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | VFYNXKZVOUXHDX-VDPUEHCXSA-N |
|---|
| SMILES | CCN(CC)C(=O)COc1cc2c(O)c3c(O)c(C)c4c(c13)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|---|
Synonyms
| Rifomycin B diethylamide |
| N,N-Diethylrifamycin B amide |
| rifamycin-B diethylamide |
| Rifocin M |
| rifamycin-M-14 |
| Rifamycin-B-diaethylamid |
| Rifocina M |
| Rifomycin M14 |
| RIFAMIDE |
| RF M-14 |
