Introduction：Basic information about CAS 54089-45-1|n-(3,4-methylenedioxybenzylidene)benzyl&, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | n-(3,4-methylenedioxybenzylidene)benzyl& |
|---|
| CAS Number | 54089-45-1 | Molecular Weight | 239.26900 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 372.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H13NO2 | Melting Point | 69.5-70ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 145.1ºC |
|---|
| Symbol |
GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 1-(1,3-benzodioxol-5-yl)-N-benzylmethanimine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 372.1ºC at 760mmHg |
|---|
| Melting Point | 69.5-70ºC(lit.) |
|---|
| Molecular Formula | C15H13NO2 |
|---|
| Molecular Weight | 239.26900 |
|---|
| Flash Point | 145.1ºC |
|---|
| Exact Mass | 239.09500 |
|---|
| PSA | 30.82000 |
|---|
| LogP | 3.03440 |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | BGNGXFPSLBOGHI-UHFFFAOYSA-N |
|---|
| SMILES | C(=NCc1ccccc1)c1ccc2c(c1)OCO2 |
|---|
Safety Information
| Symbol |
GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T,N |
|---|
| Risk Phrases | 25-37/38-41-51/53 |
|---|
| Safety Phrases | 26-36/37/39-45-61 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
Synonyms
| 3,4-methylenedioxybenzylidenebenzylamine |
| piperonal N-benzylimine |
| N-benzylpiperonylideneamine |
| piperonal-benzylimine |
| MFCD00115461 |
