Introduction：Basic information about CAS 6279-93-2|Methanone, (2-bromophenyl)(2,4,6-trimethylphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone, (2-bromophenyl)(2,4,6-trimethylphenyl)- |
|---|
| CAS Number | 6279-93-2 | Molecular Weight | 303.19400 |
|---|
| Density | 1.303g/cm3 | Boiling Point | 360.4ºC at 760mmHg |
|---|
| Molecular Formula | C16H15BrO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 23.2ºC |
|---|
Names
| Name | (2-bromophenyl)-(2,4,6-trimethylphenyl)methanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.303g/cm3 |
|---|
| Boiling Point | 360.4ºC at 760mmHg |
|---|
| Molecular Formula | C16H15BrO |
|---|
| Molecular Weight | 303.19400 |
|---|
| Flash Point | 23.2ºC |
|---|
| Exact Mass | 302.03100 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.60530 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | GBBHLKRNXLWUMF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2Br)c(C)c1 |
|---|
Synonyms
| 2-Bromophenyl mesityl ketone |
| 2'-Brom-2,4,6-trimethyl-benzophenon |
| 2'-bromo-2,4,6-trimethyl-benzophenone |
| (2-bromophenyl)(2,4,6-trimethylphenyl)methanone |
