Introduction:Basic information about CAS 462-10-2|4,4'-Dithiobis[2-aminobutyric Acid], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Dithiobis[2-aminobutyric Acid] |
|---|
| CAS Number | 462-10-2 | Molecular Weight | 268.354 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 507.6±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H16N2O4S2 | Melting Point | 281-284ºC (dec.) |
|---|
| MSDS | / | Flash Point | 260.8±30.1 °C |
|---|
Names
| Name | homocystine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 507.6±50.0 °C at 760 mmHg |
|---|
| Melting Point | 281-284ºC (dec.) |
|---|
| Molecular Formula | C8H16N2O4S2 |
|---|
| Molecular Weight | 268.354 |
|---|
| Flash Point | 260.8±30.1 °C |
|---|
| Exact Mass | 268.055145 |
|---|
| PSA | 177.24000 |
|---|
| LogP | 1.03 |
|---|
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.619 |
|---|
| InChIKey | ZTVZLYBCZNMWCF-UHFFFAOYSA-N |
|---|
| SMILES | NC(CCSSCCC(N)C(=O)O)C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S22-S24/25 |
|---|
Synonyms
| L-4,4'-dithio-bis(2-aminobutanoic acid) |
| L-Homocystine |
| 4,4'-dithiobis[2-amino-Butanoic acid] |
| 4,4'-Disulfanediylbis(2-aminobutanoic acid) |
| 4,4-Dithiobis[2-Aminobutyric] Acid |
| 4,4'-Disulfanediylbis(2-aminobutansäure) |
| 4,4'-dithiobis[2-aminobutyric] acid |
| Butanoic acid, 4,4'-dithiobis[2-amino- |
| 4,4'-Dithiobis[2-aminobutanoic Acid] |
| 4,4-Dithiobis[2-Amino-Butanoic Acid] |
| 4,4'-Dithiobis[2-aminobutyric Acid] |
| L-4,4'-Dithiobis(2-aminobutyric acid) |
| homocystine |
| DL-Homocystine |