Introduction：Basic information about CAS 89530-34-7|1-PHENYL-3-(TRIMETHYLSILYL)-2-PROPYN-1-&, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-PHENYL-3-(TRIMETHYLSILYL)-2-PROPYN-1-& |
|---|
| CAS Number | 89530-34-7 | Molecular Weight | 204.34000 |
|---|
| Density | 0.993g/cm3 | Boiling Point | 281.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16OSi | Melting Point | / |
|---|
| MSDS | / | Flash Point | 124.3ºC |
|---|
Names
| Name | 1-phenyl-3-trimethylsilylprop-2-yn-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.993g/cm3 |
|---|
| Boiling Point | 281.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16OSi |
|---|
| Molecular Weight | 204.34000 |
|---|
| Flash Point | 124.3ºC |
|---|
| Exact Mass | 204.09700 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 2.60080 |
|---|
| Index of Refraction | 1.52 |
|---|
| InChIKey | RVTDALNDYLDVMN-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(C)C#CC(O)c1ccccc1 |
|---|
Safety Information
Synonyms
| 3-(trimethylsilyl)-1-phenyl-2-propyn-1-ol |
| 1-phenyl-3-trimethylsilanyl-prop-2-yn-1-ol |
| Benzenemethanol,a-[2-(trimethylsilyl)ethynyl] |
| 1-phenyl-3-trimethylsilyl-prop-2-yn-1-ol |
| 1-Phenyl-3-(trimethylsilyl)-2-propyn-1-ol |
| phenyl-3-(trimethylsilyl)prop-2-yn-1-ol |
