Introduction:Basic information about CAS 74098-29-6|6-chloro-3,4-dimethyl-2-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-chloro-3,4-dimethyl-2-nitrophenol |
|---|
| CAS Number | 74098-29-6 | Molecular Weight | 201.60700 |
|---|
| Density | 1.398g/cm3 | Boiling Point | 268.9ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 116.4ºC |
|---|
Names
| Name | 6-chloro-3,4-dimethyl-2-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.398g/cm3 |
|---|
| Boiling Point | 268.9ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8ClNO3 |
|---|
| Molecular Weight | 201.60700 |
|---|
| Flash Point | 116.4ºC |
|---|
| Exact Mass | 201.01900 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 3.09380 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | LMTRWXYYWXXVHD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cl)c(O)c([N+](=O)[O-])c1C |
|---|
Safety Information
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 6-chloro-3,4-dimethyl-2-nitro-phenol |
| 6-Chlor-2-nitro-asymm.-o-xylenol |
| 2-Chloro-4,5-dimethyl-6-nitrophenol |
| OR1536 |
| 5-Chlor-3-nitro-1-oxy-o-xylol |
| 6-Chlor-3,4-dimethyl-2-nitro-phenol |