Introduction：Basic information about CAS 10539-19-2|1-Benzyl-3-ethyl-6,7-dimethoxyisoquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Benzyl-3-ethyl-6,7-dimethoxyisoquinoline |
|---|
| CAS Number | 10539-19-2 | Molecular Weight | 307.38600 |
|---|
| Density | 1.109g/cm3 | Boiling Point | 441.2ºC at 760mmHg |
|---|
| Molecular Formula | C20H21NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158.7ºC |
|---|
Names
| Name | 1-Benzyl-3-ethyl-6,7-dimethoxyisoquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.109g/cm3 |
|---|
| Boiling Point | 441.2ºC at 760mmHg |
|---|
| Molecular Formula | C20H21NO2 |
|---|
| Molecular Weight | 307.38600 |
|---|
| Flash Point | 158.7ºC |
|---|
| Exact Mass | 307.15700 |
|---|
| PSA | 31.35000 |
|---|
| LogP | 4.40520 |
|---|
| Vapour Pressure | 1.44E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | MYCMTMIGRXJNSO-UHFFFAOYSA-N |
|---|
| SMILES | CCc1cc2cc(OC)c(OC)cc2c(Cc2ccccc2)n1 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-Ethyl-1-benzyl-6,7-dimethoxyisoquinoline |
| Moxaverinum |
| Paverine |
| Isoquinoline,3-ethyl-6,7-dimethoxy-1-(phenylmethyl) |
| Eupaverin |
| 1-benzyl-3-ethyl-6,7-dimethoxy-isoquinoline |
| 1-Benzyl-3-ethyl-6,7-dimethoxyisochinolin |
| Moxaverine |
| Moxaverina |
