Introduction:Basic information about CAS 100858-32-0|Benzyl 3-hydroxy-1-pyrrolidinecarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzyl 3-hydroxy-1-pyrrolidinecarboxylate |
|---|
| CAS Number | 100858-32-0 | Molecular Weight | 221.252 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 370.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H15NO3 | Melting Point | 71-77ºC |
|---|
| MSDS | USA | Flash Point | 178.0±27.9 °C |
|---|
| Symbol | GHS06 | Signal Word | Danger |
|---|
Names
| Name | (S)-(+)-1-Cbz-3-pyrrolidinol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 370.7±42.0 °C at 760 mmHg |
|---|
| Melting Point | 71-77ºC |
|---|
| Molecular Formula | C12H15NO3 |
|---|
| Molecular Weight | 221.252 |
|---|
| Flash Point | 178.0±27.9 °C |
|---|
| Exact Mass | 221.105194 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 0.54 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | MBLJFGOKYTZKMH-NSHDSACASA-N |
|---|
| SMILES | O=C(OCc1ccccc1)N1CCC(O)C1 |
|---|
Safety Information
| Symbol | GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T:Toxic; |
|---|
| Risk Phrases | R25;R36/37/38 |
|---|
| Safety Phrases | S26-S36-S45 |
|---|
| RIDADR | UN 2811 |
|---|
| WGK Germany | 3.0 |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-Pyrrolidinecarboxylic acid, 3-hydroxy-, phenylmethyl ester, (3S)- |
| (3S)-3-Hydroxypyrrolidine-1-carboxylate de benzyle |
| Benzyl (3S)-3-hydroxy-1-pyrrolidinecarboxylate |
| (S)-1-Carbobenzoxy-3-pyrrolidinol |
| Benzyl (3S)-3-hydroxypyrrolidine-1-carboxylate |
| Benzyl 3-hydroxy-1-pyrrolidinecarboxylate |
| (S)-1-Benzyloxycarbonyl-3-pyrrolidinol |
| (S)-1-Cbz-3-pyrrolidinol |
| (S)-1-Carbobenzoxy-3-hydroxypyrrolidine |
| 1-Pyrrolidinecarboxylic acid, 3-hydroxy-, phenylmethyl ester |
| Benzyl 3-hydroxypyrrolidine-1-carboxylate |
| Benzyl-(3S)-3-hydroxypyrrolidin-1-carboxylat |
| (S)-N-Z-3-Pyrrolidinol |
| (S)-(+)-1-Cbz-3-Pyrrolidinol |