Introduction：Basic information about CAS 103957-56-8|3,4-Dimethylphenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4-Dimethylphenylalanine |
|---|
| CAS Number | 103957-56-8 | Molecular Weight | 193.242 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 342.8±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.1±24.6 °C |
|---|
Names
| Name | 2-amino-3-(3,4-dimethylphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 342.8±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H15NO2 |
|---|
| Molecular Weight | 193.242 |
|---|
| Flash Point | 161.1±24.6 °C |
|---|
| Exact Mass | 193.110275 |
|---|
| PSA | 63.32000 |
|---|
| LogP | 2.03 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | QVTAHBOLRJHIJE-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(CC(N)C(=O)O)cc1C.Cl |
|---|
Synonyms
| Phenylalanine, 3,4-dimethyl- |
| L-Phenylalanine,3,4-dimethyl |
| 3,4-Dimethylphenylalanine |
| 3,4-Dimethyl-DL-Phenylalanine |
