Introduction:Basic information about CAS 146277-48-7|D-2,4,6-trimethylphenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D-2,4,6-trimethylphenylalanine |
|---|
| CAS Number | 146277-48-7 | Molecular Weight | 207.269 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 357.2±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H17NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.8±24.6 °C |
|---|
Names
| Name | (2R)-2-amino-3-(2,4,6-trimethylphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 357.2±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H17NO2 |
|---|
| Molecular Weight | 207.269 |
|---|
| Flash Point | 169.8±24.6 °C |
|---|
| Exact Mass | 207.125931 |
|---|
| PSA | 63.32000 |
|---|
| LogP | 2.49 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | CRNOZLNQYAUXRK-LLVKDONJSA-N |
|---|
| SMILES | Cc1cc(C)c(CC(N)C(=O)O)c(C)c1 |
|---|
Synonyms
| D-Phenylalanine, 2,4,6-trimethyl- |
| 2,4,6-Trimethyl-D-phenylalanine |
| D-2,4,6-trimethylphenylalanine |
| 2,3-dihydro-5-methyl-7-trifluormethyl-1h-1,4-diazepine |