Introduction：Basic information about CAS 2981-93-3|4,5,6,7-Tetramethoxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,5,6,7-Tetramethoxy-2-naphthoic acid |
|---|
| CAS Number | 2981-93-3 | Molecular Weight | 292.28400 |
|---|
| Density | 1.259g/cm3 | Boiling Point | 449.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.2ºC |
|---|
Names
| Name | 4,5,6,7-Tetramethoxy-2-naphthoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.259g/cm3 |
|---|
| Boiling Point | 449.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16O6 |
|---|
| Molecular Weight | 292.28400 |
|---|
| Flash Point | 166.2ºC |
|---|
| Exact Mass | 292.09500 |
|---|
| PSA | 74.22000 |
|---|
| LogP | 2.57240 |
|---|
| Vapour Pressure | 7.23E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | XODCCPKBMAFCKY-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2cc(C(=O)O)cc(OC)c2c(OC)c1OC |
|---|
Synonyms
| tetraiodophthalimide |
| 4,5,6,7-Tetrajod-isoindolin-1,3-dion |
| 4,5,6,7-tetraiodo-isoindoline-1,3-dione |
