Introduction：Basic information about CAS 4147-30-2|8-Bromo-4-hydroxy-5,6-dimethoxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-Bromo-4-hydroxy-5,6-dimethoxy-2-naphthoic acid |
|---|
| CAS Number | 4147-30-2 | Molecular Weight | 327.12700 |
|---|
| Density | 1.646g/cm3 | Boiling Point | 496.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11BrO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 254.1ºC |
|---|
Names
| Name | 8-Bromo-4-hydroxy-5,6-dimethoxy-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Density | 1.646g/cm3 |
|---|
| Boiling Point | 496.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11BrO5 |
|---|
| Molecular Weight | 327.12700 |
|---|
| Flash Point | 254.1ºC |
|---|
| Exact Mass | 325.97900 |
|---|
| PSA | 75.99000 |
|---|
| LogP | 3.02330 |
|---|
| Index of Refraction | 1.666 |
|---|
| InChIKey | LJFLFXIJRPLPDZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(Br)c2cc(C(=O)O)cc(O)c2c1OC |
|---|
