Introduction:Basic information about CAS 22280-85-9|6-Hydroxy-4,5-dimethoxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Hydroxy-4,5-dimethoxy-2-naphthoic acid |
|---|
| CAS Number | 22280-85-9 | Molecular Weight | 248.23100 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 456.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 178.4ºC |
|---|
Names
| Name | 6-Hydroxy-4,5-dimethoxy-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 456.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O5 |
|---|
| Molecular Weight | 248.23100 |
|---|
| Flash Point | 178.4ºC |
|---|
| Exact Mass | 248.06800 |
|---|
| PSA | 75.99000 |
|---|
| LogP | 2.26080 |
|---|
| Vapour Pressure | 3.84E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.646 |
|---|
| InChIKey | CZBVTUGRFOPYFF-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(=O)O)cc2ccc(O)c(OC)c12 |
|---|