Introduction:Basic information about CAS 103028-63-3|5-nitroquinolin-6-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-nitroquinolin-6-ol |
|---|
| CAS Number | 103028-63-3 | Molecular Weight | 190.15600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H6N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-nitroquinolin-6-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C9H6N2O3 |
|---|
| Molecular Weight | 190.15600 |
|---|
| Exact Mass | 190.03800 |
|---|
| PSA | 78.94000 |
|---|
| LogP | 2.37180 |
|---|
| InChIKey | VNTMHRXHQYOVLK-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1c(O)ccc2ncccc12 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-Quinolinol,5-nitro |
| 5-nitro-quinolin-6-ol |
| RW3144 |
| 6-hydroxy-5-nitroquinoline |
| 5-nitro-6-hydroxyquinoline |
| 5-Nitro-chinolin-6-ol |