Introduction：Basic information about CAS 100821-48-5|1H-Indole-3-carboxylic acid, 6-Methyl-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Indole-3-carboxylic acid, 6-Methyl-, ethyl ester |
|---|
| CAS Number | 100821-48-5 | Molecular Weight | 203.23700 |
|---|
| Density | 1.177g/cm3 | Boiling Point | 349.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H13NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.2ºC |
|---|
Names
| Name | Ethyl 6-methyl-1H-indole-3-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.177g/cm3 |
|---|
| Boiling Point | 349.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H13NO2 |
|---|
| Molecular Weight | 203.23700 |
|---|
| Flash Point | 165.2ºC |
|---|
| Exact Mass | 203.09500 |
|---|
| PSA | 42.09000 |
|---|
| LogP | 2.65300 |
|---|
| Vapour Pressure | 4.64E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | JHKVKHVMRYKOBW-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1c[nH]c2cc(C)ccc12 |
|---|
