Introduction：Basic information about CAS 69386-36-3|2-tert-butyl-9H-carbazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-tert-butyl-9H-carbazole |
|---|
| CAS Number | 69386-36-3 | Molecular Weight | 223.31300 |
|---|
| Density | 1.101g/cm3 | Boiling Point | 384.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H17N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.4ºC |
|---|
Names
| Name | 2-tert-butyl-9H-carbazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.101g/cm3 |
|---|
| Boiling Point | 384.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H17N |
|---|
| Molecular Weight | 223.31300 |
|---|
| Flash Point | 167.4ºC |
|---|
| Exact Mass | 223.13600 |
|---|
| PSA | 15.79000 |
|---|
| LogP | 4.61860 |
|---|
| Index of Refraction | 1.659 |
|---|
| InChIKey | FUFORZIUGGNDKM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccc2c(c1)[nH]c1ccccc12 |
|---|
Synonyms
| 2-tert.-Butyl-carbazol |
| 2-tert-butyl-carbazole |
| 2-(2-Methyl-2-propanyl)-9H-carbazole |
