Introduction:Basic information about CAS 882041-47-6|3',6'-DIHYDRO-1-METHYL-3'-METHYLENE-SPIRO[3H-INDOLE-3,2'-[2H], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3',6'-DIHYDRO-1-METHYL-3'-METHYLENE-SPIRO[3H-INDOLE-3,2'-[2H]PYRAN]-2(1H)-ONE |
|---|
| CAS Number | 882041-47-6 | Molecular Weight | 227.25900 |
|---|
| Density | 1.248g/cm3 | Boiling Point | 457.725ºC at 760 mmHg |
|---|
| Molecular Formula | C14H13NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.624ºC |
|---|
Names
| Name | 1'-methyl-5-methylidenespiro[2H-pyran-6,3'-indole]-2'-one |
|---|
Chemical & Physical Properties
| Density | 1.248g/cm3 |
|---|
| Boiling Point | 457.725ºC at 760 mmHg |
|---|
| Molecular Formula | C14H13NO2 |
|---|
| Molecular Weight | 227.25900 |
|---|
| Flash Point | 230.624ºC |
|---|
| Exact Mass | 227.09500 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 2.06590 |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | PTAGFPLVYUUASM-UHFFFAOYSA-N |
|---|
| SMILES | C=C1C=CCOC12C(=O)N(C)c1ccccc12 |
|---|