Introduction：Basic information about CAS 62374-67-8|Benzenesulfonyl chloride, 4-(acetylamino)-2-methyl- (9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonyl chloride, 4-(acetylamino)-2-methyl- (9CI) |
|---|
| CAS Number | 62374-67-8 | Molecular Weight | 247.69900 |
|---|
| Density | 1.411 g/cm3 | Boiling Point | 422.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10ClNO3S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 209.3ºC |
|---|
Names
| Name | 4-Acetamido-2-methylbenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.411 g/cm3 |
|---|
| Boiling Point | 422.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10ClNO3S |
|---|
| Molecular Weight | 247.69900 |
|---|
| Flash Point | 209.3ºC |
|---|
| Exact Mass | 247.00700 |
|---|
| PSA | 75.11000 |
|---|
| LogP | 3.61120 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | CQMOYSYLLYARBD-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Cl)c(C)c1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 5-acetylamino-toluene-2-sulfonyl chloride |
| 4-Acetylamino-2-methylbenzolsulphonylchlorid |
| Benzenesulfonyl chloride,4-(acetylamino)-2-methyl |
| 4-acetylamino-2-methyl-benzenesulfonyl chloride |
| 5-Acetamino-toluol-sulfonylchlorid-(2) |
| 4-Acetylamino-2-methyl-benzenesulphonic acid chloride |
| 5-Acetylamino-toluol-2-sulfonylchlorid |
| 4-acetamino-2-methyl-benzenesulfonyl chloride |
