Introduction:Basic information about CAS 23023-91-8|Flucrilate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Flucrilate |
|---|
| CAS Number | 23023-91-8 | Molecular Weight | 193.12300 |
|---|
| Density | 1.265g/cm3 | Boiling Point | 207.9ºC at 760mmHg |
|---|
| Molecular Formula | C7H6F3NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 79.5ºC |
|---|
Names
| Name | 1,1,1-trifluoropropan-2-yl 2-cyanoprop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.265g/cm3 |
|---|
| Boiling Point | 207.9ºC at 760mmHg |
|---|
| Molecular Formula | C7H6F3NO2 |
|---|
| Molecular Weight | 193.12300 |
|---|
| Flash Point | 79.5ºC |
|---|
| Exact Mass | 193.03500 |
|---|
| PSA | 50.09000 |
|---|
| LogP | 1.56018 |
|---|
| Vapour Pressure | 0.22mmHg at 25°C |
|---|
| Index of Refraction | 1.389 |
|---|
| InChIKey | MEKBIVQWPIRQNE-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C#N)C(=O)OC(C)C(F)(F)F |
|---|
Safety Information
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Flucrilate |
| Flucrylate (USAN/INN) |
| FLUCRYLATE |
| Flucrilato |
| 2-(1,1,1-trifluoro)-iso-propyl-2-cyanoacrylat |
| Flucrilatum |
| Flucrilatum [INN-Latin] |
| 2-(1,1,1-Trifluor)-propyl-cyanoacrylat |
| Flucrilate (INN) |
| (1,1,1-Trifluorprop-2-yl)2-cyanacrylat |