Introduction:Basic information about CAS 83733-82-8|fosmethilan, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fosmethilan |
|---|
| CAS Number | 83733-82-8 | Molecular Weight | 367.85200 |
|---|
| Density | 1.324g/cm3 | Boiling Point | 456.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H19ClNO3PS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.2ºC |
|---|
Names
| Name | fosmethilan |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.324g/cm3 |
|---|
| Boiling Point | 456.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H19ClNO3PS2 |
|---|
| Molecular Weight | 367.85200 |
|---|
| Flash Point | 230.2ºC |
|---|
| Exact Mass | 367.02300 |
|---|
| PSA | 105.97000 |
|---|
| LogP | 5.33170 |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | MVBGKYGTNGPFHT-UHFFFAOYSA-N |
|---|
| SMILES | CCCC(=O)N(CSP(=S)(OC)OC)c1ccccc1Cl |
|---|
Safety Information
| Hazard Codes | T,N |
|---|
| Risk Phrases | R24/25;R50/53 |
|---|
| Safety Phrases | S36/37-S45-S60-S61 |
|---|
| HS Code | 2930909064 |
|---|
Customs
| HS Code | 2930909064 |
|---|
| Summary | 2930909064 s-((n-(2-chlorophenyl)butyramido)methyl) o,o-dimethyl phosphorodithioate |
|---|
Synonyms
| Fosmethilan |
| Nevifosz 50 EC |
| Nevifos |
| S-{[N-(2-chlorophenyl)butanamido]methyl} O,O-dimethyl phosphorodithioate |
| S-[N-(2-chlorophenyl)butyramidomethyl] O,O-dimethyl phosphorodithioate |
| S-[[(2-chlorophenyl)(1-oxobutyl)amino]methyl] O,O-dimethyl phosphorodithioate |
| N-(2-chlorophenyl)-N-(dimethoxyphosphinothioylsulfanylmethyl)butanamide |
| Fosmetilan |
| 2’-chloro-N-(dimethoxyphosphinothioylthiomethyl)butyranilide |
| Fosmethilan [ISO] |
| PHOSMETHYLAN |
| Nevifos 50 |