Introduction：Basic information about CAS 60248-23-9|1-(furan-2-yl)-3-[2-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]benzimi, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(furan-2-yl)-3-[2-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]benzimidazol-1-yl]propan-1-one |
|---|
| CAS Number | 60248-23-9 | Molecular Weight | 454.56300 |
|---|
| Density | 1.19g/cm3 | Boiling Point | 658.7ºC at 760 mmHg |
|---|
| Molecular Formula | C28H30N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 352.2ºC |
|---|
Names
| Name | 1-(furan-2-yl)-3-[2-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]benzimidazol-1-yl]propan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.19g/cm3 |
|---|
| Boiling Point | 658.7ºC at 760 mmHg |
|---|
| Molecular Formula | C28H30N4O2 |
|---|
| Molecular Weight | 454.56300 |
|---|
| Flash Point | 352.2ºC |
|---|
| Exact Mass | 454.23700 |
|---|
| PSA | 54.51000 |
|---|
| LogP | 4.60910 |
|---|
| Index of Refraction | 1.632 |
|---|
| InChIKey | HMTJIKVWJRSKMY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CCn1c(CN2CCN(CC=Cc3ccccc3)CC2)nc2ccccc21)c1ccco1 |
|---|
Synonyms
| Fuprazolum |
| Fuprazolum [INN-Latin] |
| Fuprazol |
| Fuprazol [INN-Spanish] |
| Fuprazole |
| Fuprazole [INN] |
| UNII-47JUM7D622 |
