Introduction：Basic information about CAS 23031-38-1|furamethrin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | furamethrin |
|---|
| CAS Number | 23031-38-1 | Molecular Weight | 286.36500 |
|---|
| Density | 1.109g/cm3 | Boiling Point | 343.7ºC at 760mmHg |
|---|
| Molecular Formula | C18H22O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.6ºC |
|---|
Names
| Name | furamethrin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.109g/cm3 |
|---|
| Boiling Point | 343.7ºC at 760mmHg |
|---|
| Molecular Formula | C18H22O3 |
|---|
| Molecular Weight | 286.36500 |
|---|
| Flash Point | 161.6ºC |
|---|
| Exact Mass | 286.15700 |
|---|
| PSA | 39.44000 |
|---|
| LogP | 3.73690 |
|---|
| InChIKey | FSYXMFXBRJFYBS-UHFFFAOYSA-N |
|---|
| SMILES | C#CCc1ccc(COC(=O)C2C(C=C(C)C)C2(C)C)o1 |
|---|
Synonyms
| 5-prop-2-ynylfurfuryl (1RS,3RS |
| Prothrin |
| [5-(2-propyn-1-yl)-2-furanyl]methyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate |
| 5-Propargylfurfuryl chrysanthemate |
| 5-Propargyl-2-furylmethyl dl-cis,trans-chrysanthemate |
| Furamethrin,racemic |
| Pynamin D |
| chrysanthemum-monocarboxylic acid 5-propargyl-2-furyl methyl ester |
| Pynamin D forte |
| 5-prop-2-ynylfurfuryl (1RS)-cis,trans-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
| 5-(2-Propynyl)-2-furfuryl chrysanthemumcarboxylate |
| [5-(prop-2-yn-1-yl)furan-2-yl]methyl (1Ξ,3Ξ)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate |
| 5-Propargylfurfurylester der Chrysanthemummonocarboxysaeure |
| 1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
| FURAMETHRIN |
| (5-prop-2-ynylfuran-2-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| 5-propargylfurfuryl (±)-cis-trans-chrysanthemate |
| 5-propargylfurfurylester of chrysanthemumic acid |
