Introduction:Basic information about CAS 112839-33-5|furconazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | furconazole |
|---|
| CAS Number | 112839-33-5 | Molecular Weight | 396.19200 |
|---|
| Density | 1.52g/cm3 | Boiling Point | 489.9ºC at 760mmHg |
|---|
| Molecular Formula | C15H14Cl2F3N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 250.1ºC |
|---|
Names
| Name | furconazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Boiling Point | 489.9ºC at 760mmHg |
|---|
| Molecular Formula | C15H14Cl2F3N3O2 |
|---|
| Molecular Weight | 396.19200 |
|---|
| Flash Point | 250.1ºC |
|---|
| Exact Mass | 395.04200 |
|---|
| PSA | 49.17000 |
|---|
| LogP | 4.19580 |
|---|
| Vapour Pressure | 9.57E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | ULCWZQJLFZEXCS-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)COC1CCC(Cn2cncn2)(c2ccc(Cl)cc2Cl)O1 |
|---|
Synonyms
| 1-{[2-(2,4-Dichlorophenyl)-5-(2,2,2-trifluoroethoxy)tetrahydro-2- furanyl]methyl}-1H-1,2,4-triazole |
| Furcloprofeno [INN-Spanish] |
| (2RS,5RS |
| Furcloprofene [INN-French] |
| Furcloprofenum [INN-Latin] |
| Furcloprofen |
| (2RS,5RS)-5-(2,4-dichlorophenyl)tetrahydro-5-(1H-1,2,4-triazole-1-ylmethyl)-furan-2-yl 2,2,2-trifluoroethyl ether |
| 2RS,5SR)-5-(2,4-dichlorophenyl)tetrahydro-5-(1H-1,2,4-triazol-1-ylmethyl)-2-furyl 2,2,2-trifluoroethyl ether |
| Furcloprofene |
| 1-[[2-(2,4-dichlorophenyl)tetrahydro-5-(2,2,2-trifluoroethoxy)-2-furanyl]methyl]-1H-1,2,4-triazole |
| Furconazole-cis |
| 1-{[(2Ξ,5Ξ)-2-(2,4-dichlorophenyl)-5-(2,2,2-trifluoroethoxy)oxolan-2-yl]methyl}-1H-1,2,4-triazole |
| Furcloprofeno |
| Furcloprofenum |