Introduction:Basic information about CAS 7761-75-3|Furterene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Furterene |
|---|
| CAS Number | 7761-75-3 | Molecular Weight | 243.22500 |
|---|
| Density | 1.606g/cm3 | Boiling Point | 561.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9N7O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 293.2ºC |
|---|
Names
| Name | 6-(furan-2-yl)pteridine-2,4,7-triamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.606g/cm3 |
|---|
| Boiling Point | 561.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9N7O |
|---|
| Molecular Weight | 243.22500 |
|---|
| Flash Point | 293.2ºC |
|---|
| Exact Mass | 243.08700 |
|---|
| PSA | 144.22000 |
|---|
| LogP | 0.86780 |
|---|
| Index of Refraction | 1.822 |
|---|
| InChIKey | HCNBCFYKPSFHLH-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc(N)c2nc(-c3ccco3)c(N)nc2n1 |
|---|
Synonyms
| furamterene |
| Furtereno [INN-Spanish] |
| Furterene [INN:DCF] |
| Furterene |
| 2,4,7-Triamino-6-(2-furyl)-pteridin |
| 6-furan-2-yl-pteridine-2,4,7-triamine |
| Furtereno |
| Furterenum |
| Furterenum [INN-Latin] |