Introduction：Basic information about CAS 90850-05-8|Gloximonam, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Gloximonam |
|---|
| CAS Number | 90850-05-8 | Molecular Weight | 471.48500 |
|---|
| Density | 1.48g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C18H25N5O8S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-[(2-Methyl-2-propanyl)oxy]-2-oxoethyl {[(2S,3S)-3-{[(2Z)-2-(2-a mino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-2-methyl-4-o xo-1-azetidinyl]oxy}acetate |
|---|
Chemical & Physical Properties
| Density | 1.48g/cm3 |
|---|
| Molecular Formula | C18H25N5O8S |
|---|
| Molecular Weight | 471.48500 |
|---|
| Exact Mass | 471.14200 |
|---|
| PSA | 204.20000 |
|---|
| LogP | 0.31610 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | QPWVHJDIDXILDG-UHFFFAOYSA-N |
|---|
| SMILES | CON=C(C(=O)NC1C(=O)N(OCC(=O)OCC(=O)OC(C)(C)C)C1C)c1csc(N)n1 |
|---|
