Introduction：Basic information about CAS 32797-92-5|Glipentide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Glipentide |
|---|
| CAS Number | 32797-92-5 | Molecular Weight | 445.53200 |
|---|
| Density | 1.32g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C22H27N3O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-[2-[4-(cyclopentylcarbamoylsulfamoyl)phenyl]ethyl]-2-methoxybenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Molecular Formula | C22H27N3O5S |
|---|
| Molecular Weight | 445.53200 |
|---|
| Exact Mass | 445.16700 |
|---|
| PSA | 128.96000 |
|---|
| LogP | 4.84910 |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | NSJYMFYVNWVGON-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccccc1C(=O)NCCc1ccc(S(=O)(=O)NC(=O)NC2CCCC2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| Glisentide |
| Staticum (TN) |
| Glypentide |
| Glisentida |
| N-{2-[4-({[(cycIopentyIamino)carbonyI]amino}suIfonyl)phenyI]ethyI}-2-methoxybenzamide |
| Glisentide (INN) |
| N-{2-[4-({[(cyclopentylamino)carbonyl]amino}sulfonyl)phenyl]ethyl}-2-methoxybenzamide |
| Glisentidum |
| Glipentide |
| Glipentida |
| Glipentidum |
