Introduction：Basic information about CAS 24645-20-3|2-(4-Cyclohexylphenyl)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-Cyclohexylphenyl)propanoic acid |
|---|
| CAS Number | 24645-20-3 | Molecular Weight | 232.31800 |
|---|
| Density | 1.078g/cm3 | Boiling Point | 377.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H20O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 273.9ºC |
|---|
Names
| Name | 2-(4-Cyclohexylphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.078g/cm3 |
|---|
| Boiling Point | 377.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H20O2 |
|---|
| Molecular Weight | 232.31800 |
|---|
| Flash Point | 273.9ºC |
|---|
| Exact Mass | 232.14600 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.92240 |
|---|
| Vapour Pressure | 2.35E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | YTUMWOBUZOYYJQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C(=O)O)c1ccc(C2CCCCC2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Hexaprofen |
| CHPPA |
| EINECS 246-379-8 |
| 4-Cyclohexyl-hydratropaesure |
| Hexaprofene [INN-French] |
| Hexaprofenum [INN-Latin] |
| Hexaprofeno [INN-Spanish] |
| 2-(4-cyclohexyl-phenyl)-propionic acid |
| 2-(4-Cyclohexylphenyl)propionsaeure |
