Introduction：Basic information about CAS 7303-78-8|Imidoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Imidoline |
|---|
| CAS Number | 7303-78-8 | Molecular Weight | 267.75500 |
|---|
| Density | 1.209 g/cm3 | Boiling Point | 372.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H18ClN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 179.2ºC |
|---|
Names
| Name | 1-(3-chlorophenyl)-3-[2-(dimethylamino)ethyl]imidazolidin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.209 g/cm3 |
|---|
| Boiling Point | 372.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H18ClN3O |
|---|
| Molecular Weight | 267.75500 |
|---|
| Flash Point | 179.2ºC |
|---|
| Exact Mass | 267.11400 |
|---|
| PSA | 26.79000 |
|---|
| LogP | 2.14650 |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | KACVTTZEMNWITH-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)CCN1CCN(c2cccc(Cl)c2)C1=O |
|---|
Safety Information
Synonyms
| UNII-DR3D6KY80G |
| 1-(m-Chlorophenyl)-3-(2-dimethylaminoethyl)-2-imidazolidinone |
| Imidoline |
| Imidoline [INN] |
| Imidolina |
| Imidolina [INN-Spanish] |
| Imidolinum |
| Imidolinum [INN-Latin] |
| 1-(m-Chlorphenyl)-3-(2-dimethylaminoethyl)-2-imidazolidinon |
| 1-(3-chloro-phenyl)-3-(2-dimethylamino-ethyl)-imidazolidin-2-one |
