Introduction:Basic information about CAS 117086-68-7|Ricasetron, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ricasetron |
|---|
| CAS Number | 117086-68-7 | Molecular Weight | 313.437 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 478.4±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H27N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 243.1±28.7 °C |
|---|
Names
| Name | 3,3-Dimethyl-N-[(3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl]-1- indolinecarboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 478.4±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H27N3O |
|---|
| Molecular Weight | 313.437 |
|---|
| Flash Point | 243.1±28.7 °C |
|---|
| Exact Mass | 313.215424 |
|---|
| PSA | 39.07000 |
|---|
| LogP | 3.31 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | ILXWRFDRNAKTDD-GOOCMWNKSA-N |
|---|
| SMILES | CN1C2CCC1CC(NC(=O)N1CC(C)(C)c3ccccc31)C2 |
|---|
Synonyms
| 3,3-Dimethyl-N-((3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl)indoline-1-carboxamide |
| 3,3-dimethyl-N-[(3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl]-2,3-dihydro-1H-indole-1-carboxamide |
| 1H-Indole-1-carboxamide, 2,3-dihydro-3,3-dimethyl-N-[(3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl]- |
| 3,3-Dimethyl-N-[(3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl]indoline-1-carboxamide |
| 3,3-Dimethyl-N-1aH,5aH-tropan-3a-yl-1-indolinecarboxamide |
| endo-2,3-Dihydro-3,3-dimethyl-N-(8-methyl-8-azabicyclo[3.2.1]oct-3-yl)-1H-indole-1-carboxamide |
| 3,3-Dimethyl-N-[(3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl]-1-indolinecarboxamide |
| Ricasetron |