Introduction：Basic information about CAS 23419-43-4|Ridaflone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ridaflone |
|---|
| CAS Number | 23419-43-4 | Molecular Weight | 413.43500 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 520.9ºC at 760mmHg |
|---|
| Molecular Formula | C23H22F3N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 268.8ºC |
|---|
Names
| Name | 4-Phenyl-2-[2-(1-pyrrolidinyl)ethyl]-6-[3-(trifluoromethyl)phenyl ]-3(2H)-pyridazinone |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 520.9ºC at 760mmHg |
|---|
| Molecular Formula | C23H22F3N3O |
|---|
| Molecular Weight | 413.43500 |
|---|
| Flash Point | 268.8ºC |
|---|
| Exact Mass | 413.17100 |
|---|
| PSA | 38.13000 |
|---|
| LogP | 4.62980 |
|---|
| Vapour Pressure | 5.99E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | QZZKQYACHMVOFV-UHFFFAOYSA-N |
|---|
| SMILES | O=c1c(-c2ccccc2)cc(-c2cccc(C(F)(F)F)c2)nn1CCN1CCCC1 |
|---|
