Introduction:Basic information about CAS 57184-22-2|r 761, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | r 761 |
|---|
| CAS Number | 57184-22-2 | Molecular Weight | 837.99500 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 980.7ºC at 760mmHg |
|---|
| Molecular Formula | C45H63N3O12 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 546.9ºC |
|---|
Names
| Name | Rifandin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 980.7ºC at 760mmHg |
|---|
| Molecular Formula | C45H63N3O12 |
|---|
| Molecular Weight | 837.99500 |
|---|
| Flash Point | 546.9ºC |
|---|
| Exact Mass | 837.44100 |
|---|
| PSA | 211.28000 |
|---|
| LogP | 5.62010 |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | XUBKCCSAVNRWOX-BVHPQESASA-N |
|---|
| SMILES | COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(c(N5CCN(CC(C)C)CC5)c(O)c4c3C2=O)NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| Isobutylpiperazinylrifamycin SV |
| 3-(4-Isobutyl-1-piperazinyl)-rifamycin SV |
| Rifamycin,3-[4-(2-methylpropyl)-1-piperazinyl] |
| 3-(4-Isobutyl-1-piperazinyl)rifamycin |
| R 761 |