Introduction：Basic information about CAS 107052-56-2|Romergoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Romergoline |
|---|
| CAS Number | 107052-56-2 | Molecular Weight | 350.41400 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 629.7ºC at 760 mmHg |
|---|
| Molecular Formula | C20H22N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 334.6ºC |
|---|
Names
| Name | 4-[[(6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-yl]methyl]piperazine-2,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 629.7ºC at 760 mmHg |
|---|
| Molecular Formula | C20H22N4O2 |
|---|
| Molecular Weight | 350.41400 |
|---|
| Flash Point | 334.6ºC |
|---|
| Exact Mass | 350.17400 |
|---|
| PSA | 71.93000 |
|---|
| LogP | 1.14770 |
|---|
| Vapour Pressure | 9.09E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.715 |
|---|
| InChIKey | RJCXNCSJGRUWRW-SJKOYZFVSA-N |
|---|
| SMILES | CN1CC(CN2CC(=O)NC(=O)C2)C=C2c3cccc4[nH]cc(c34)CC21 |
|---|
Synonyms
| 2,6-Piperazinedione,4-(((8beta)-9,10-didehydro-6-methylergolin-8-yl)methyl) |
| 4-((9,10-Didehydro-6-methylergolin-8beta-yl)methyl)-2,6-piperazinedione |
| Romergoline [INN] |
| UNII-I4880ZI08R |
| Romergoline |
