Introduction：Basic information about CAS 55530-41-1|Rotamicillin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Rotamicillin |
|---|
| CAS Number | 55530-41-1 | Molecular Weight | 549.64100 |
|---|
| Density | 1.46g/cm3 | Boiling Point | 948.2ºC at 760 mmHg |
|---|
| Molecular Formula | C28H31N5O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 527.3ºC |
|---|
Names
| Name | (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[[(2R)-2-phenyl-2-[[2-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]acetyl]amino]acetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.46g/cm3 |
|---|
| Boiling Point | 948.2ºC at 760 mmHg |
|---|
| Molecular Formula | C28H31N5O5S |
|---|
| Molecular Weight | 549.64100 |
|---|
| Flash Point | 527.3ºC |
|---|
| Exact Mass | 549.20500 |
|---|
| PSA | 172.48000 |
|---|
| LogP | 2.84110 |
|---|
| Index of Refraction | 1.716 |
|---|
| InChIKey | PXNNCSKFUDOUJS-ZUVQJFRASA-N |
|---|
| SMILES | CC1(C)SC2C(NC(=O)C(NC(=O)Cc3ccc(C4=NCCCN4)cc3)c3ccccc3)C(=O)N2C1C(=O)O |
|---|
Synonyms
| (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-((R)-2-phenyl-2-(2-(4-(1,4,5,6-tetrahydro-2-pyrimidinyl)phenyl)acetamido(acetamido-4-thia-1-azabicyclo(3.2.0)heptan-2-carboxylic acid |
| Rotamicillina |
| Rotamicillinum |
| Rotamicilline |
| Rotamicillin |
| Rotamicillin [INN] |
