Introduction：Basic information about CAS 5560-77-0|Rotoxamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Rotoxamine |
|---|
| CAS Number | 5560-77-0 | Molecular Weight | 290.78800 |
|---|
| Density | 1.143g/cm3 | Boiling Point | 381.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H19ClN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 184.3ºC |
|---|
Names
| Name | (S)-carbinoxamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.143g/cm3 |
|---|
| Boiling Point | 381.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H19ClN2O |
|---|
| Molecular Weight | 290.78800 |
|---|
| Flash Point | 184.3ºC |
|---|
| Exact Mass | 290.11900 |
|---|
| PSA | 25.36000 |
|---|
| LogP | 3.40260 |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | OJFSXZCBGQGRNV-INIZCTEOSA-N |
|---|
| SMILES | CN(C)CCOC(c1ccc(Cl)cc1)c1ccccn1 |
|---|
Synonyms
| (-)-carbinoxamine |
| Twiston |
| Rotoxamine [USAN] |
| levocarbinoxamine |
| (L)-Carbinoxamine |
| Rotoxamine (USAN/INN) |
| Rotoxamina |
| Rotoxaminum |
| 2-[(S)-(4-chlorophenyl)-pyridin-2-ylmethoxy]-N,N-dimethylethanamine |
