Introduction:Basic information about CAS 88939-40-6|Semorphone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Semorphone |
|---|
| CAS Number | 88939-40-6 | Molecular Weight | 345.39000 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 543.9ºC at 760 mmHg |
|---|
| Molecular Formula | C19H23NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 282.7ºC |
|---|
Names
| Name | (5α)-3,14-Dihydroxy-17-(2-methoxyethyl)-4,5-epoxymorphinan-6-one |
|---|
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 543.9ºC at 760 mmHg |
|---|
| Molecular Formula | C19H23NO5 |
|---|
| Molecular Weight | 345.39000 |
|---|
| Flash Point | 282.7ºC |
|---|
| Exact Mass | 345.15800 |
|---|
| PSA | 79.23000 |
|---|
| LogP | 0.69970 |
|---|
| Index of Refraction | 1.67 |
|---|
| InChIKey | PBGIBLLOMGURPS-GRGSLBFTSA-N |
|---|
| SMILES | COCCN1CCC23c4c5ccc(O)c4OC2C(=O)CCC3(O)C1C5 |
|---|