Introduction:Basic information about CAS 54063-55-7|Sulfaclorazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sulfaclorazole |
|---|
| CAS Number | 54063-55-7 | Molecular Weight | 362.83400 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 573.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H15ClN4O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 300.5ºC |
|---|
Names
| Name | 4-amino-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]benzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 573.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H15ClN4O2S |
|---|
| Molecular Weight | 362.83400 |
|---|
| Flash Point | 300.5ºC |
|---|
| Exact Mass | 362.06000 |
|---|
| PSA | 98.39000 |
|---|
| LogP | 4.95210 |
|---|
| Index of Refraction | 1.681 |
|---|
| InChIKey | TZSHGYFVCVETTH-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)n(-c2cccc(Cl)c2)n1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| Sulfaclorazole [INN] |
| UNII-13HX5F227D |
| N1-(1-(3-Chlorphenyl)-3-methyl-5-pyrazolyl)sulfanilamid |
| 4-amino-N-[1-(3-chlorophenyl)-3-methyl-1H-pyrazol-5-yl]benzenesulfonamide |
| Sulfaclorazole |
| Sulfaclorazolum |
| 4-amino-N-[2-(3-chloro-phenyl)-5-methyl-2H-pyrazol-3-yl]-benzenesulfonamide |
| Sulfanilamide,N1-(1-(m-chlorophenyl)-3-methylpyrazol-5-yl) |
| 5-(4-Amino-benzolsulfonylamino)-1-(3-chlorphenyl)-3-methyl-pyrazol |